CAS 18073-21-7 is the registry number for 6-Bromo-1,4-dimethyl-9H-carbazole-3-carbaldehyde, 95%. Offered by: AmBeed. Available pack sizes: 1g.
6-bromo-1,4-dimethyl-9H-carbazole-3-carbaldehyde (CAS 18073-21-7) is a chemical compound with the molecular formula C15H12BrNO and a molecular weight of 302.16 g/mol. IUPAC name: 6-bromo-1,4-dimethyl-9H-carbazole-3-carbaldehyde. InChIKey: LJFSNATUOFWLPQ-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO |
|---|---|
| Molecular weight | 302.16 g/mol |
| IUPAC name | 6-bromo-1,4-dimethyl-9H-carbazole-3-carbaldehyde |
| InChIKey | LJFSNATUOFWLPQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C2=C1NC3=C2C=C(C=C3)Br)C)C=O |
Computed by PubChem (NCBI)