CAS 134430-89-0 is the registry number for (E)-N-(4-Bromophenyl)-3-phenyl-2-propenamide. Offered by: TRC. Available pack sizes: 1g, 250mg, 500mg.
(E)-N-(4-bromophenyl)-3-phenylprop-2-enamide (CAS 134430-89-0) is a chemical compound with the molecular formula C15H12BrNO and a molecular weight of 302.16 g/mol. IUPAC name: (E)-N-(4-bromophenyl)-3-phenylprop-2-enamide. InChIKey: CPHIJOVRKMUDKW-IZZDOVSWSA-N.
| Molecular formula | C15H12BrNO |
|---|---|
| Molecular weight | 302.16 g/mol |
| IUPAC name | (E)-N-(4-bromophenyl)-3-phenylprop-2-enamide |
| InChIKey | CPHIJOVRKMUDKW-IZZDOVSWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)NC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)