CAS 1447816-61-6 is the registry number for 1-Benzyl-7-bromo-2,3-dihydro-1H-indol-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-benzyl-7-bromo-3H-indol-2-one (CAS 1447816-61-6) is a chemical compound with the molecular formula C15H12BrNO and a molecular weight of 302.16 g/mol. IUPAC name: 1-benzyl-7-bromo-3H-indol-2-one. InChIKey: YKIDTDRQOGVDFL-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO |
|---|---|
| Molecular weight | 302.16 g/mol |
| IUPAC name | 1-benzyl-7-bromo-3H-indol-2-one |
| InChIKey | YKIDTDRQOGVDFL-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC=C2)Br)N(C1=O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)