Products 52181-36-9
CAS 52181-36-9 is the registry number for 5-Bromo-3-methyl-3-phenylindolin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-3-methyl-3-phenyl-1H-indol-2-one (CAS 52181-36-9) is a chemical compound with the molecular formula C15H12BrNO and a molecular weight of 302.16 g/mol. IUPAC name: 5-bromo-3-methyl-3-phenyl-1H-indol-2-one. InChIKey: GTIQDACYKPUDML-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO |
|---|---|
| Molecular weight | 302.16 g/mol |
| IUPAC name | 5-bromo-3-methyl-3-phenyl-1H-indol-2-one |
| InChIKey | GTIQDACYKPUDML-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)Br)NC1=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)