CAS 1956368-15-2 appears in our catalog under these names: KB–05, N-(4-Bromophenyl)-N-phenylacrylamide, KB-05, 99.83%, KB-05, 95%. Offered by: GLPBio, Biosynth, MedChemExpress, Ambeed. Available pack sizes: 1mg, 5mg, 50mg, 5 mg, 50 mg, 10 mg, 10mM/1mL, 25 mg.
N-(4-bromophenyl)-N-phenylprop-2-enamide (CAS 1956368-15-2) is a chemical compound with the molecular formula C15H12BrNO and a molecular weight of 302.16 g/mol. IUPAC name: N-(4-bromophenyl)-N-phenylprop-2-enamide. InChIKey: WFQQVUPOAKOTGT-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO |
|---|---|
| Molecular weight | 302.16 g/mol |
| IUPAC name | N-(4-bromophenyl)-N-phenylprop-2-enamide |
| InChIKey | WFQQVUPOAKOTGT-UHFFFAOYSA-N |
| SMILES | C=CC(=O)N(C1=CC=CC=C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)