Products 91714-41-9
CAS 91714-41-9 appears in our catalog under these names: Bromfenac Impurity 7, Bromfenac Impurity 12, (4–bromophenyl)(2，3–dihydro–1H–indol–7–yl)methanone. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 250mg, 50mg.
(4-bromophenyl)-(2,3-dihydro-1H-indol-7-yl)methanone (CAS 91714-41-9) is a chemical compound with the molecular formula C15H12BrNO and a molecular weight of 302.16 g/mol. IUPAC name: (4-bromophenyl)-(2,3-dihydro-1H-indol-7-yl)methanone. InChIKey: LXJUSQJYSGMLNA-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO |
|---|---|
| Molecular weight | 302.16 g/mol |
| IUPAC name | (4-bromophenyl)-(2,3-dihydro-1H-indol-7-yl)methanone |
| InChIKey | LXJUSQJYSGMLNA-UHFFFAOYSA-N |
| SMILES | C1CNC2=C1C=CC=C2C(=O)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)