CAS 1807891-13-9 appears in our catalog under these names: Rac-methyl 1-((3R,4S)-4-hydroxyoxolan-3-yl)-1H-1,2,3-triazole-4-carboxylate, 95%, rac-Methyl 1-((3R,4S)-4-hydroxyoxolan-3-yl)-1H-1,2,3-triazole-4-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 1-[(3R,4S)-4-hydroxyoxolan-3-yl]triazole-4-carboxylate (CAS 1807891-13-9) is a chemical compound with the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. IUPAC name: methyl 1-[(3R,4S)-4-hydroxyoxolan-3-yl]triazole-4-carboxylate. InChIKey: XVKRKAHAGSIFFG-RNFRBKRXSA-N.
| Molecular formula | C8H11N3O4 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | methyl 1-[(3R,4S)-4-hydroxyoxolan-3-yl]triazole-4-carboxylate |
| InChIKey | XVKRKAHAGSIFFG-RNFRBKRXSA-N |
| SMILES | COC(=O)C1=CN(N=N1)[C@@H]2COC[C@H]2O |
Computed by PubChem (NCBI)