Products 1807895-92-6
CAS 1807895-92-6 is the registry number for rac-(2R,3R)-2-(1-(2-Methoxyethyl)-1H-pyrazol-4-yl)oxolane-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2R,3R)-2-[1-(2-methoxyethyl)pyrazol-4-yl]oxolane-3-carboxylic acid (CAS 1807895-92-6) is a chemical compound with the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. IUPAC name: (2R,3R)-2-[1-(2-methoxyethyl)pyrazol-4-yl]oxolane-3-carboxylic acid. InChIKey: KVJAVNHHFPQJPU-ZJUUUORDSA-N.
| Molecular formula | C11H16N2O4 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | (2R,3R)-2-[1-(2-methoxyethyl)pyrazol-4-yl]oxolane-3-carboxylic acid |
| InChIKey | KVJAVNHHFPQJPU-ZJUUUORDSA-N |
| SMILES | COCCN1C=C(C=N1)[C@H]2[C@@H](CCO2)C(=O)O |
Computed by PubChem (NCBI)