CAS 1807920-91-7 appears in our catalog under these names: rel-(1R,2R)-2-(Difluoromethyl)cyclopropan-1-amine hydrochloride, 98%, Trans,rel-(1R,2R)-2-(difluoromethyl)cyclopropan-1-amine hydrochloride, rac-(1R,2R)-2-(difluoromethyl)cyclopropan-1-amine hydrochloride, 97%, 97%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 0,5g, 50mg, 100mg, 250mg, 500mg.
Trans-(1R,2R)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride (CAS 1807920-91-7) is a chemical compound with the molecular formula C4H8ClF2N and a molecular weight of 143.56 g/mol. IUPAC name: trans-(1R,2R)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride. InChIKey: UYTDZEGHUBNTBD-SWLXLVAMSA-N.
| Molecular formula | C4H8ClF2N |
|---|---|
| Molecular weight | 143.56 g/mol |
| IUPAC name | trans-(1R,2R)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | UYTDZEGHUBNTBD-SWLXLVAMSA-N |
| SMILES | C1[C@H]([C@@H]1N)C(F)F.Cl |
Computed by PubChem (NCBI)