Products 1820573-97-4
CAS 1820573-97-4 is the registry number for (1S,2S)-2-(Difluoromethyl)cyclopropan-1-amine hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Trans-(1S,2S)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride (CAS 1820573-97-4) is a chemical compound with the molecular formula C4H8ClF2N and a molecular weight of 143.56 g/mol. IUPAC name: trans-(1S,2S)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride. InChIKey: UYTDZEGHUBNTBD-GVOALSEPSA-N.
| Molecular formula | C4H8ClF2N |
|---|---|
| Molecular weight | 143.56 g/mol |
| IUPAC name | trans-(1S,2S)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | UYTDZEGHUBNTBD-GVOALSEPSA-N |
| SMILES | C1[C@@H]([C@H]1N)C(F)F.Cl |
Computed by PubChem (NCBI)