CAS 2307780-91-0 appears in our catalog under these names: rel-(1R,2S)-2-(Difluoromethyl)cyclopropan-1-amine hydrochloride, 98%, rac-(1R,2S)-2-(Difluoromethyl)cyclopropan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
Cis-(1R,2S)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride (CAS 2307780-91-0) is a chemical compound with the molecular formula C4H8ClF2N and a molecular weight of 143.56 g/mol. IUPAC name: cis-(1R,2S)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride. InChIKey: UYTDZEGHUBNTBD-LJUKVTEVSA-N.
| Molecular formula | C4H8ClF2N |
|---|---|
| Molecular weight | 143.56 g/mol |
| IUPAC name | cis-(1R,2S)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | UYTDZEGHUBNTBD-LJUKVTEVSA-N |
| SMILES | C1[C@@H]([C@@H]1N)C(F)F.Cl |
Computed by PubChem (NCBI)