CAS 2059915-48-7 appears in our catalog under these names: rac-(1R,2R)-2-(difluoromethyl)cyclopropan-1-amine hydrochloride, trans, 95%, 95%, (1R,2R)-2-(Difluoromethyl)cyclopropan-1-amine hydrochloride, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Trans-(1R,2R)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride (CAS 2059915-48-7) is a chemical compound with the molecular formula C4H8ClF2N and a molecular weight of 143.56 g/mol. IUPAC name: trans-(1R,2R)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride. InChIKey: UYTDZEGHUBNTBD-SWLXLVAMSA-N.
| Molecular formula | C4H8ClF2N |
|---|---|
| Molecular weight | 143.56 g/mol |
| IUPAC name | trans-(1R,2R)-2-(difluoromethyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | UYTDZEGHUBNTBD-SWLXLVAMSA-N |
| SMILES | C1[C@H]([C@@H]1N)C(F)F.Cl |
Computed by PubChem (NCBI)