CAS 1807940-14-2 appears in our catalog under these names: (4R)-8-Methyl-3,4-dihydro-2h-1-benzopyran-4-amine hydrochloride, 95%, (4R)-8-Methyl-3,4-dihydro-2H-1-benzopyran-4-amine hydrochloride, (4R)-8-Methyl-3,4-dihydro-2H-1-benzopyran-4-amine hcl, 97%, 97%, (4R)-8-Methyl-3,4-dihydro-2H-1-benzopyran-4-amine hcl, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 2,5g, 100mg.
(4R)-8-methyl-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 1807940-14-2) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: (4R)-8-methyl-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: UOOASZNLOHDNQY-SBSPUUFOSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | (4R)-8-methyl-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | UOOASZNLOHDNQY-SBSPUUFOSA-N |
| SMILES | CC1=C2C(=CC=C1)[C@@H](CCO2)N.Cl |
Computed by PubChem (NCBI)