CAS 191608-12-5 appears in our catalog under these names: 8-Methylchroman-4-amine hydrochloride, 95%, 8-Methylchroman-4-amine hydrochloride, 95+%, 8-Methylchroman-4-amine hydrochloride, 8-Methylchroman-4-amine hydrochloride, 95+%, 95+%, 8-Methyl-3,4-dihydro-2h-1-benzopyran-4-amine hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 0,5g, 100mg, 500mg.
8-methyl-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 191608-12-5) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: 8-methyl-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: UOOASZNLOHDNQY-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | 8-methyl-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | UOOASZNLOHDNQY-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(CCO2)N.Cl |
Computed by PubChem (NCBI)