CAS 1807940-39-1 is the registry number for rac-(2R,3R)-2-(3,5-Dimethyl-1-phenyl-1H-pyrazol-4-yl)oxolane-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2R,3R)-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)oxolane-3-carboxylic acid (CAS 1807940-39-1) is a chemical compound with the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. IUPAC name: (2R,3R)-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)oxolane-3-carboxylic acid. InChIKey: KKSDIAFMUQPDPN-UKRRQHHQSA-N.
| Molecular formula | C16H18N2O3 |
|---|---|
| Molecular weight | 286.33 g/mol |
| IUPAC name | (2R,3R)-2-(3,5-dimethyl-1-phenylpyrazol-4-yl)oxolane-3-carboxylic acid |
| InChIKey | KKSDIAFMUQPDPN-UKRRQHHQSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=CC=C2)C)[C@H]3[C@@H](CCO3)C(=O)O |
Computed by PubChem (NCBI)