CAS 1808153-79-8 is the registry number for 4-((Aminocarbonyl)amino)-D-phenylalanine. Offered by: TRC. Available pack sizes: 25mg.
(2R)-2-amino-3-[4-(carbamoylamino)phenyl]propanoic acid (CAS 1808153-79-8) is a chemical compound with the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. IUPAC name: (2R)-2-amino-3-[4-(carbamoylamino)phenyl]propanoic acid. InChIKey: ZTAKYRNNPKFXGS-MRVPVSSYSA-N.
| Molecular formula | C10H13N3O3 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | (2R)-2-amino-3-[4-(carbamoylamino)phenyl]propanoic acid |
| InChIKey | ZTAKYRNNPKFXGS-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC=C1C[C@H](C(=O)O)N)NC(=O)N |
Computed by PubChem (NCBI)