Products 1809063-18-0
CAS 1809063-18-0 is the registry number for Methyl (1S,2S)-2-[[(1,1-dimethylethoxy)carbonyl]amino]cyclohexanecarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Trans-methyl (1S,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate (CAS 1809063-18-0) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: trans-methyl (1S,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate. InChIKey: AWNIRXMMYAJMNG-UWVGGRQHSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | trans-methyl (1S,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate |
| InChIKey | AWNIRXMMYAJMNG-UWVGGRQHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCC[C@@H]1C(=O)OC |
Computed by PubChem (NCBI)