CAS 180915-62-2 appears in our catalog under these names: (S)-6-Methoxy-2,3-dihydro-1h-inden-1-amine hydrochloride, 95%, (S)-6-Methoxy-2,3-dihydro-1H-inden-1-amine hydrochloride, 97%, (S)-6-Methoxy-2,3-dihydro-1H-inden-1-amine hydrochloride, 97%, 97%, (S)-6-Methoxy-2,3-dihydro-1H-inden-1-aminehydrochloride, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 500mg.
(1S)-6-methoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 180915-62-2) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: (1S)-6-methoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: KJDASQBFJKUGFC-PPHPATTJSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | (1S)-6-methoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | KJDASQBFJKUGFC-PPHPATTJSA-N |
| SMILES | COC1=CC2=C(CC[C@@H]2N)C=C1.Cl |
Computed by PubChem (NCBI)