CAS 730980-51-5 appears in our catalog under these names: (R)-6-Methoxy-2,3-dihydro-1H-inden-1-amine hydrochloride, 97%, (R)–6–Methoxy–2,3–dihydro–1H–inden–1–amine hydrochloride, (R)-6-Methoxy-2,3-dihydro-1H-inden-1-amine hydrochloride, 97%, 97%, (R)-6-Methoxy-2,3-dihydro-1H-inden-1-aminehydrochloride, 97%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
(1R)-6-methoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 730980-51-5) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: (1R)-6-methoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: KJDASQBFJKUGFC-HNCPQSOCSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | (1R)-6-methoxy-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | KJDASQBFJKUGFC-HNCPQSOCSA-N |
| SMILES | COC1=CC2=C(CC[C@H]2N)C=C1.Cl |
Computed by PubChem (NCBI)