CAS 1809322-55-1 is the registry number for 2-(2,4-Difluorophenyl)-5-methoxypyridine, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(2,4-difluorophenyl)-5-methoxypyridine (CAS 1809322-55-1) is a chemical compound with the molecular formula C12H9F2NO and a molecular weight of 221.20 g/mol. IUPAC name: 2-(2,4-difluorophenyl)-5-methoxypyridine. InChIKey: SYIIATIJMPEZFQ-UHFFFAOYSA-N.
| Molecular formula | C12H9F2NO |
|---|---|
| Molecular weight | 221.20 g/mol |
| IUPAC name | 2-(2,4-difluorophenyl)-5-methoxypyridine |
| InChIKey | SYIIATIJMPEZFQ-UHFFFAOYSA-N |
| SMILES | COC1=CN=C(C=C1)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)