CAS 18107-02-3 appears in our catalog under these names: 2-(Pyrimidin-2-yl)-1H-benzo[d]imidazole, 95%, 95%, 1H-Benzimidazole, 2-(2-pyrimidinyl)-, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-pyrimidin-2-yl-1H-benzimidazole (CAS 18107-02-3) is a chemical compound with the molecular formula C11H8N4 and a molecular weight of 196.21 g/mol. IUPAC name: 2-pyrimidin-2-yl-1H-benzimidazole. InChIKey: WTZRQYJHRXQWTK-UHFFFAOYSA-N.
| Molecular formula | C11H8N4 |
|---|---|
| Molecular weight | 196.21 g/mol |
| IUPAC name | 2-pyrimidin-2-yl-1H-benzimidazole |
| InChIKey | WTZRQYJHRXQWTK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)C3=NC=CC=N3 |
Computed by PubChem (NCBI)