CAS 181517-09-9 appears in our catalog under these names: 1,1'-Carbonyldiimidazole-13C, 1,1'-Carbonyldiimidazole-13C (>90%), ¹³C-CDI. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 10mg, 1mg, 5mg.
Di(imidazol-1-yl)(113C)methanone (CAS 181517-09-9) is a chemical compound with the molecular formula C7H6N4O and a molecular weight of 163.14 g/mol. IUPAC name: di(imidazol-1-yl)(113C)methanone. InChIKey: PFKFTWBEEFSNDU-CDYZYAPPSA-N.
| Molecular formula | C7H6N4O |
|---|---|
| Molecular weight | 163.14 g/mol |
| IUPAC name | di(imidazol-1-yl)(113C)methanone |
| InChIKey | PFKFTWBEEFSNDU-CDYZYAPPSA-N |
| SMILES | C1=CN(C=N1)[13C](=O)N2C=CN=C2 |
Computed by PubChem (NCBI)