Products 2363787-46-4

CAS 2363787-46-4 is the registry number for 1,1'-Carbonyldiimidazole-d6, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g, 0,05g.

Structural formula: {0} (CAS {1})

Bis(2,4,5-trideuterioimidazol-1-yl)methanone (CAS 2363787-46-4) is a chemical compound with the molecular formula C7H6N4O and a molecular weight of 168.19 g/mol. IUPAC name: bis(2,4,5-trideuterioimidazol-1-yl)methanone. InChIKey: PFKFTWBEEFSNDU-MZWXYZOWSA-N.

Identity
Molecular formulaC7H6N4O
Molecular weight168.19 g/mol
IUPAC namebis(2,4,5-trideuterioimidazol-1-yl)methanone
InChIKeyPFKFTWBEEFSNDU-MZWXYZOWSA-N
SMILES[2H]C1=C(N(C(=N1)[2H])C(=O)N2C(=C(N=C2[2H])[2H])[2H])[2H]

Computed by PubChem (NCBI)