Products 1816283-20-1
CAS 1816283-20-1 is the registry number for 4-Chloro-2-(pentafluoroethyl)pyridine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-chloro-2-(1,1,2,2,2-pentafluoroethyl)pyridine (CAS 1816283-20-1) is a chemical compound with the molecular formula C7H3ClF5N and a molecular weight of 231.55 g/mol. IUPAC name: 4-chloro-2-(1,1,2,2,2-pentafluoroethyl)pyridine. InChIKey: ASGAWEVNGFJCIS-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF5N |
|---|---|
| Molecular weight | 231.55 g/mol |
| IUPAC name | 4-chloro-2-(1,1,2,2,2-pentafluoroethyl)pyridine |
| InChIKey | ASGAWEVNGFJCIS-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1Cl)C(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)