Products 1817679-24-5
CAS 1817679-24-5 is the registry number for 6-Chloro-[3,4'-bipyridin]-2'-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(6-chloro-3-pyridinyl)pyridin-2-amine (CAS 1817679-24-5) is a chemical compound with the molecular formula C10H8ClN3 and a molecular weight of 205.64 g/mol. IUPAC name: 4-(6-chloro-3-pyridinyl)pyridin-2-amine. InChIKey: PDWVGYJSYPXSEX-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3 |
|---|---|
| Molecular weight | 205.64 g/mol |
| IUPAC name | 4-(6-chloro-3-pyridinyl)pyridin-2-amine |
| InChIKey | PDWVGYJSYPXSEX-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C2=CC(=NC=C2)N)Cl |
Computed by PubChem (NCBI)