Products 1818412-05-3
CAS 1818412-05-3 appears in our catalog under these names: 2，2–difluoro–2–(4–nitrophenyl)ethan–1–ol, 2,2-difluoro-2-(4-nitrophenyl)ethan-1-ol. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg.
2,2-difluoro-2-(4-nitrophenyl)ethanol (CAS 1818412-05-3) is a chemical compound with the molecular formula C8H7F2NO3 and a molecular weight of 203.14 g/mol. IUPAC name: 2,2-difluoro-2-(4-nitrophenyl)ethanol. InChIKey: QGWMXAGHODOIPO-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO3 |
|---|---|
| Molecular weight | 203.14 g/mol |
| IUPAC name | 2,2-difluoro-2-(4-nitrophenyl)ethanol |
| InChIKey | QGWMXAGHODOIPO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CO)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)