Products 1819-30-3

CAS 1819-30-3 is the registry number for Mono(n-pentyl) Terephthalate. Offered by: TRC. Available pack sizes: 250mg, 25mg.

Structural formula: {0} (CAS {1})

4-pentoxycarbonylbenzoic acid (CAS 1819-30-3) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: 4-pentoxycarbonylbenzoic acid. InChIKey: NNDJLMZMBNIBPJ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16O4
Molecular weight236.26 g/mol
IUPAC name4-pentoxycarbonylbenzoic acid
InChIKeyNNDJLMZMBNIBPJ-UHFFFAOYSA-N
SMILESCCCCCOC(=O)C1=CC=C(C=C1)C(=O)O

Computed by PubChem (NCBI)