CAS 181950-53-8 appears in our catalog under these names: 4-Chloro-7,8-dimethylquinoline, 95%, 4-Chloro-7,8-dimethylquinoline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 250mg, 2,5g.
4-chloro-7,8-dimethylquinoline (CAS 181950-53-8) is a chemical compound with the molecular formula C11H10ClN and a molecular weight of 191.65 g/mol. IUPAC name: 4-chloro-7,8-dimethylquinoline. InChIKey: JVVPYRJTPJOCFZ-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | 4-chloro-7,8-dimethylquinoline |
| InChIKey | JVVPYRJTPJOCFZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=NC=CC(=C2C=C1)Cl)C |
Computed by PubChem (NCBI)