Products 1819991-87-1
CAS 1819991-87-1 is the registry number for 2-(2,4-Dihydroxybenzoyl)terephthalic acid. Offered by: Biosynth. Available pack sizes: 0,025kg, 0,01kg, 0,05kg.
2-(2,4-dihydroxybenzoyl)terephthalic acid (CAS 1819991-87-1) is a chemical compound with the molecular formula C15H10O7 and a molecular weight of 302.23 g/mol. IUPAC name: 2-(2,4-dihydroxybenzoyl)terephthalic acid. InChIKey: XEWDKKONSOGMLG-UHFFFAOYSA-N.
| Molecular formula | C15H10O7 |
|---|---|
| Molecular weight | 302.23 g/mol |
| IUPAC name | 2-(2,4-dihydroxybenzoyl)terephthalic acid |
| InChIKey | XEWDKKONSOGMLG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C(=O)C2=C(C=C(C=C2)O)O)C(=O)O |
Computed by PubChem (NCBI)