CAS 1820569-44-5 is the registry number for tert-Butyl (2S,4S)-4-amino-2-methylpiperidine-1-carboxylate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (2S,4S)-4-amino-2-methylpiperidine-1-carboxylate;hydrochloride (CAS 1820569-44-5) is a chemical compound with the molecular formula C11H23ClN2O2 and a molecular weight of 250.76 g/mol. IUPAC name: tert-butyl (2S,4S)-4-amino-2-methylpiperidine-1-carboxylate;hydrochloride. InChIKey: ZBWBFOOJHFNICW-OZZZDHQUSA-N.
| Molecular formula | C11H23ClN2O2 |
|---|---|
| Molecular weight | 250.76 g/mol |
| IUPAC name | tert-butyl (2S,4S)-4-amino-2-methylpiperidine-1-carboxylate;hydrochloride |
| InChIKey | ZBWBFOOJHFNICW-OZZZDHQUSA-N |
| SMILES | C[C@H]1C[C@H](CCN1C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)