CAS 1820575-68-5 appears in our catalog under these names: trans–2–(2–chlorophenyl)cyclopropan–1–amine hydrochloride, rac-(1R,2S)-2-(2-chlorophenyl)cyclopropan-1-amine hydrochloride, trans. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 500mg, 5g.
Trans-(1R,2S)-2-(2-chlorophenyl)cyclopropan-1-amine;hydrochloride (CAS 1820575-68-5) is a chemical compound with the molecular formula C9H11Cl2N and a molecular weight of 204.09 g/mol. IUPAC name: trans-(1R,2S)-2-(2-chlorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: UEADQUZTMDKYMY-DKXTVVGFSA-N.
| Molecular formula | C9H11Cl2N |
|---|---|
| Molecular weight | 204.09 g/mol |
| IUPAC name | trans-(1R,2S)-2-(2-chlorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | UEADQUZTMDKYMY-DKXTVVGFSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC=CC=C2Cl.Cl |
Computed by PubChem (NCBI)