Products 1820607-19-9
CAS 1820607-19-9 is the registry number for 7-fluoro-6-methoxy-1,3-benzoxazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
7-fluoro-6-methoxy-1,3-benzoxazol-2-amine (CAS 1820607-19-9) is a chemical compound with the molecular formula C8H7FN2O2 and a molecular weight of 182.15 g/mol. IUPAC name: 7-fluoro-6-methoxy-1,3-benzoxazol-2-amine. InChIKey: VVHPYURSHKNJHX-UHFFFAOYSA-N.
| Molecular formula | C8H7FN2O2 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | 7-fluoro-6-methoxy-1,3-benzoxazol-2-amine |
| InChIKey | VVHPYURSHKNJHX-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)N=C(O2)N)F |
Computed by PubChem (NCBI)