CAS 2306278-45-3 is the registry number for 5-Fluoro-7-nitro-indoline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-fluoro-7-nitro-2,3-dihydro-1H-indole (CAS 2306278-45-3) is a chemical compound with the molecular formula C8H7FN2O2 and a molecular weight of 182.15 g/mol. IUPAC name: 5-fluoro-7-nitro-2,3-dihydro-1H-indole. InChIKey: YTEBZBNKENYUSR-UHFFFAOYSA-N.
| Molecular formula | C8H7FN2O2 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | 5-fluoro-7-nitro-2,3-dihydro-1H-indole |
| InChIKey | YTEBZBNKENYUSR-UHFFFAOYSA-N |
| SMILES | C1CNC2=C1C=C(C=C2[N+](=O)[O-])F |
Computed by PubChem (NCBI)