CAS 1845696-07-2 is the registry number for 5-Fluoro-2,6-dimethoxypyridine-3-carbonitrile, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 25g, 5g.
5-fluoro-2,6-dimethoxypyridine-3-carbonitrile (CAS 1845696-07-2) is a chemical compound with the molecular formula C8H7FN2O2 and a molecular weight of 182.15 g/mol. IUPAC name: 5-fluoro-2,6-dimethoxypyridine-3-carbonitrile. InChIKey: GLMOMZLNZMONFP-UHFFFAOYSA-N.
| Molecular formula | C8H7FN2O2 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | 5-fluoro-2,6-dimethoxypyridine-3-carbonitrile |
| InChIKey | GLMOMZLNZMONFP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=N1)OC)C#N)F |
Computed by PubChem (NCBI)