CAS 2148792-20-3 is the registry number for 7-Amino-6-fluoro-3,4-dihydro-2H-1,4-benzoxazin-3-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
7-amino-6-fluoro-4H-1,4-benzoxazin-3-one (CAS 2148792-20-3) is a chemical compound with the molecular formula C8H7FN2O2 and a molecular weight of 182.15 g/mol. IUPAC name: 7-amino-6-fluoro-4H-1,4-benzoxazin-3-one. InChIKey: NQEQCIFZSDTANA-UHFFFAOYSA-N.
| Molecular formula | C8H7FN2O2 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | 7-amino-6-fluoro-4H-1,4-benzoxazin-3-one |
| InChIKey | NQEQCIFZSDTANA-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=C(C(=C2)F)N |
Computed by PubChem (NCBI)