CAS 1820614-16-1 is the registry number for 8-Methyl-6-nitro-[1,2,4]triazolo[4,3-a]pyridine, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
8-methyl-6-nitro-[1,2,4]triazolo[4,3-a]pyridine (CAS 1820614-16-1) is a chemical compound with the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. IUPAC name: 8-methyl-6-nitro-[1,2,4]triazolo[4,3-a]pyridine. InChIKey: MBINANOZUXJXOQ-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O2 |
|---|---|
| Molecular weight | 178.15 g/mol |
| IUPAC name | 8-methyl-6-nitro-[1,2,4]triazolo[4,3-a]pyridine |
| InChIKey | MBINANOZUXJXOQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN2C1=NN=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)