CAS 1820620-30-1 appears in our catalog under these names: 1-(2,3-Difluorophenyl)-1,4-diazepane dihydrochloride, 1-(2,3-Difluorophenyl)-1,4-diazepane dihydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
1-(2,3-difluorophenyl)-1,4-diazepane;dihydrochloride (CAS 1820620-30-1) is a chemical compound with the molecular formula C11H16Cl2F2N2 and a molecular weight of 285.16 g/mol. IUPAC name: 1-(2,3-difluorophenyl)-1,4-diazepane;dihydrochloride. InChIKey: DPXWOAINZSADHO-UHFFFAOYSA-N.
| Molecular formula | C11H16Cl2F2N2 |
|---|---|
| Molecular weight | 285.16 g/mol |
| IUPAC name | 1-(2,3-difluorophenyl)-1,4-diazepane;dihydrochloride |
| InChIKey | DPXWOAINZSADHO-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C2=C(C(=CC=C2)F)F.Cl.Cl |
Computed by PubChem (NCBI)