CAS 2306262-19-9 is the registry number for 2-Fluoro-5-(3-fluoropiperidin-4-yl)aniline dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluoro-5-(3-fluoropiperidin-4-yl)aniline;dihydrochloride (CAS 2306262-19-9) is a chemical compound with the molecular formula C11H16Cl2F2N2 and a molecular weight of 285.16 g/mol. IUPAC name: 2-fluoro-5-(3-fluoropiperidin-4-yl)aniline;dihydrochloride. InChIKey: VBDNHFACXMKUCW-UHFFFAOYSA-N.
| Molecular formula | C11H16Cl2F2N2 |
|---|---|
| Molecular weight | 285.16 g/mol |
| IUPAC name | 2-fluoro-5-(3-fluoropiperidin-4-yl)aniline;dihydrochloride |
| InChIKey | VBDNHFACXMKUCW-UHFFFAOYSA-N |
| SMILES | C1CNCC(C1C2=CC(=C(C=C2)F)N)F.Cl.Cl |
Computed by PubChem (NCBI)