CAS 870841-98-8 is the registry number for 1-((2,4-difluorophenyl)methyl)piperazine dihydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g.
1-[(2,4-difluorophenyl)methyl]piperazine;dihydrochloride (CAS 870841-98-8) is a chemical compound with the molecular formula C11H16Cl2F2N2 and a molecular weight of 285.16 g/mol. IUPAC name: 1-[(2,4-difluorophenyl)methyl]piperazine;dihydrochloride. InChIKey: VLXWMIIZTMVINP-UHFFFAOYSA-N.
| Molecular formula | C11H16Cl2F2N2 |
|---|---|
| Molecular weight | 285.16 g/mol |
| IUPAC name | 1-[(2,4-difluorophenyl)methyl]piperazine;dihydrochloride |
| InChIKey | VLXWMIIZTMVINP-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=C(C=C(C=C2)F)F.Cl.Cl |
Computed by PubChem (NCBI)