CAS 2098051-38-6 is the registry number for 1-(4-(Difluoromethyl)phenyl)piperazine Dihydrochloride. Offered by: TRC. Available pack sizes: 500mg.
1-[4-(difluoromethyl)phenyl]piperazine;dihydrochloride (CAS 2098051-38-6) is a chemical compound with the molecular formula C11H16Cl2F2N2 and a molecular weight of 285.16 g/mol. IUPAC name: 1-[4-(difluoromethyl)phenyl]piperazine;dihydrochloride. InChIKey: XTEMQRXPEDICAJ-UHFFFAOYSA-N.
| Molecular formula | C11H16Cl2F2N2 |
|---|---|
| Molecular weight | 285.16 g/mol |
| IUPAC name | 1-[4-(difluoromethyl)phenyl]piperazine;dihydrochloride |
| InChIKey | XTEMQRXPEDICAJ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)C(F)F.Cl.Cl |
Computed by PubChem (NCBI)