CAS 2445785-32-8 is the registry number for 1-[(2,5-Difluorophenyl)methyl]piperazine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
1-[(2,5-difluorophenyl)methyl]piperazine;dihydrochloride (CAS 2445785-32-8) is a chemical compound with the molecular formula C11H16Cl2F2N2 and a molecular weight of 285.16 g/mol. IUPAC name: 1-[(2,5-difluorophenyl)methyl]piperazine;dihydrochloride. InChIKey: VGLVNACJXSBBNC-UHFFFAOYSA-N.
| Molecular formula | C11H16Cl2F2N2 |
|---|---|
| Molecular weight | 285.16 g/mol |
| IUPAC name | 1-[(2,5-difluorophenyl)methyl]piperazine;dihydrochloride |
| InChIKey | VGLVNACJXSBBNC-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=C(C=CC(=C2)F)F.Cl.Cl |
Computed by PubChem (NCBI)