CAS 1820683-08-6 appears in our catalog under these names: Methyl 3-amino-3-(4-hydroxyphenyl)propanoate hydrochloride, 95%, Methyl 3–Amino–3–(4–hydroxyphenyl)propanoate Hydrochloride, Methyl 3-Amino-3-(4-hydroxyphenyl)propanoate Hydrochloride, ≥95%, ≥95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 100mg.
Methyl 3-amino-3-(4-hydroxyphenyl)propanoate;hydrochloride (CAS 1820683-08-6) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: methyl 3-amino-3-(4-hydroxyphenyl)propanoate;hydrochloride. InChIKey: IGCVYGRJXLFPDF-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | methyl 3-amino-3-(4-hydroxyphenyl)propanoate;hydrochloride |
| InChIKey | IGCVYGRJXLFPDF-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C1=CC=C(C=C1)O)N.Cl |
Computed by PubChem (NCBI)