CAS 1820687-72-6 appears in our catalog under these names: 2–(3,5–dimethylphenyl)–2,2–difluoroethan–1–ol, 2-(3,5-Dimethylphenyl)-2,2-difluoroethan-1-ol, 2-(3,5-dimethylphenyl)-2,2-difluoroethan-1-ol, 96%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
2-(3,5-dimethylphenyl)-2,2-difluoroethanol (CAS 1820687-72-6) is a chemical compound with the molecular formula C10H12F2O and a molecular weight of 186.20 g/mol. IUPAC name: 2-(3,5-dimethylphenyl)-2,2-difluoroethanol. InChIKey: GZFMBEQCNVUXDA-UHFFFAOYSA-N.
| Molecular formula | C10H12F2O |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | 2-(3,5-dimethylphenyl)-2,2-difluoroethanol |
| InChIKey | GZFMBEQCNVUXDA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(CO)(F)F)C |
Computed by PubChem (NCBI)