CAS 1820704-00-4 is the registry number for methyl 2-amino-6-chloro-1,3-benzoxazole-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-amino-6-chloro-1,3-benzoxazole-5-carboxylate (CAS 1820704-00-4) is a chemical compound with the molecular formula C9H7ClN2O3 and a molecular weight of 226.61 g/mol. IUPAC name: methyl 2-amino-6-chloro-1,3-benzoxazole-5-carboxylate. InChIKey: NWLLRLUBLXIMQD-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O3 |
|---|---|
| Molecular weight | 226.61 g/mol |
| IUPAC name | methyl 2-amino-6-chloro-1,3-benzoxazole-5-carboxylate |
| InChIKey | NWLLRLUBLXIMQD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1Cl)OC(=N2)N |
Computed by PubChem (NCBI)