CAS 1301214-59-4 is the registry number for Methyl 7-chloro-2-oxo-1,3-dihydro-1,3-benzodiazole-5-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
Methyl 7-chloro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylate (CAS 1301214-59-4) is a chemical compound with the molecular formula C9H7ClN2O3 and a molecular weight of 226.61 g/mol. IUPAC name: methyl 7-chloro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylate. InChIKey: VUDPLHWTJYVJSR-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O3 |
|---|---|
| Molecular weight | 226.61 g/mol |
| IUPAC name | methyl 7-chloro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylate |
| InChIKey | VUDPLHWTJYVJSR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C(=C1)Cl)NC(=O)N2 |
Computed by PubChem (NCBI)