CAS 2628352-42-9 is the registry number for 4-Chloro-5-methyl-7-nitroisoindolin-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-5-methyl-7-nitro-2,3-dihydroisoindol-1-one (CAS 2628352-42-9) is a chemical compound with the molecular formula C9H7ClN2O3 and a molecular weight of 226.61 g/mol. IUPAC name: 4-chloro-5-methyl-7-nitro-2,3-dihydroisoindol-1-one. InChIKey: QDCFYJXHTPWMAK-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O3 |
|---|---|
| Molecular weight | 226.61 g/mol |
| IUPAC name | 4-chloro-5-methyl-7-nitro-2,3-dihydroisoindol-1-one |
| InChIKey | QDCFYJXHTPWMAK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1Cl)CNC2=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)