CAS 1388041-76-6 is the registry number for Methyl 6-chloro-2-oxo-2,3-dihydro-1h-benzo[d]imidazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
Methyl 6-chloro-2-oxo-1,3-dihydrobenzimidazole-4-carboxylate (CAS 1388041-76-6) is a chemical compound with the molecular formula C9H7ClN2O3 and a molecular weight of 226.61 g/mol. IUPAC name: methyl 6-chloro-2-oxo-1,3-dihydrobenzimidazole-4-carboxylate. InChIKey: KKUVQJCHSLUYEQ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O3 |
|---|---|
| Molecular weight | 226.61 g/mol |
| IUPAC name | methyl 6-chloro-2-oxo-1,3-dihydrobenzimidazole-4-carboxylate |
| InChIKey | KKUVQJCHSLUYEQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C(=CC(=C1)Cl)NC(=O)N2 |
Computed by PubChem (NCBI)