CAS 2420419-14-1 is the registry number for Methyl 6-chloro-1-oxo-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6-chloro-1-oxo-2,3-dihydropyrrolo[3,4-c]pyridine-4-carboxylate (CAS 2420419-14-1) is a chemical compound with the molecular formula C9H7ClN2O3 and a molecular weight of 226.61 g/mol. IUPAC name: methyl 6-chloro-1-oxo-2,3-dihydropyrrolo[3,4-c]pyridine-4-carboxylate. InChIKey: NEICVPHQAWTKOV-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O3 |
|---|---|
| Molecular weight | 226.61 g/mol |
| IUPAC name | methyl 6-chloro-1-oxo-2,3-dihydropyrrolo[3,4-c]pyridine-4-carboxylate |
| InChIKey | NEICVPHQAWTKOV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2CNC(=O)C2=CC(=N1)Cl |
Computed by PubChem (NCBI)