Products 1499226-34-4
CAS 1499226-34-4 is the registry number for 2-Amino-5-chloro-benzooxazole-7-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl 2-amino-5-chloro-1,3-benzoxazole-7-carboxylate (CAS 1499226-34-4) is a chemical compound with the molecular formula C9H7ClN2O3 and a molecular weight of 226.61 g/mol. IUPAC name: methyl 2-amino-5-chloro-1,3-benzoxazole-7-carboxylate. InChIKey: YTJQFZVKTFQFAQ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O3 |
|---|---|
| Molecular weight | 226.61 g/mol |
| IUPAC name | methyl 2-amino-5-chloro-1,3-benzoxazole-7-carboxylate |
| InChIKey | YTJQFZVKTFQFAQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C(=CC(=C1)Cl)N=C(O2)N |
Computed by PubChem (NCBI)