CAS 1820708-73-3 appears in our catalog under these names: SKA-121, 98%, SKA-121, SKA–121, SKA-121, 98.22%, 98.22%, SKA-121, 99.69%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 2mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 10 mg.
5-methylbenzo[g][1,3]benzoxazol-2-amine (CAS 1820708-73-3) is a chemical compound with the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. IUPAC name: 5-methylbenzo[g][1,3]benzoxazol-2-amine. InChIKey: JEGUERWMMMQFJV-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 5-methylbenzo[g][1,3]benzoxazol-2-amine |
| InChIKey | JEGUERWMMMQFJV-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C3=CC=CC=C13)OC(=N2)N |
Computed by PubChem (NCBI)